About pentanethioamide;hydrochloride
pentanethioamide;hydrochloride (PubChem CID 140974365) has the molecular formula C5H12ClNS
and a molecular weight of 153.68 g/mol. Its IUPAC name is pentanethioamide;hydrochloride.
Molecular Properties
| Compound Name | pentanethioamide;hydrochloride |
| PubChem CID | 140974365 |
| Molecular Formula | C5H12ClNS |
| Molecular Weight | 153.68 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | pentanethioamide;hydrochloride |
| SMILES | CCCCC(N)=S.Cl |
| InChI | InChI=1S/C5H11NS.ClH/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H2,6,7);1H |
| InChIKey | OKBYHHAZRCFJTP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.68 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pentanethioamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanethioamide;hydrochloride?
The IUPAC name of pentanethioamide;hydrochloride (CID 140974365) is pentanethioamide;hydrochloride.
What is the SMILES notation for pentanethioamide;hydrochloride?
The canonical SMILES for pentanethioamide;hydrochloride is CCCCC(N)=S.Cl.
What is the InChIKey of pentanethioamide;hydrochloride?
The InChIKey is OKBYHHAZRCFJTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NS.ClH/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H2,6,7);1H.
What are the key properties of pentanethioamide;hydrochloride?
pentanethioamide;hydrochloride has a molecular weight of 153.68 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentanethioamide;hydrochloride is sourced from PubChem (CID 140974365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).