About pentanedithioic acid;stibane
pentanedithioic acid;stibane (PubChem CID 174261271) has the molecular formula C5H13S2Sb
and a molecular weight of 259.05 g/mol. Its IUPAC name is pentanedithioic acid;stibane.
Molecular Properties
| Compound Name | pentanedithioic acid;stibane |
| PubChem CID | 174261271 |
| Molecular Formula | C5H13S2Sb |
| Molecular Weight | 259.05 g/mol |
| Exact Mass | 257.95 |
| IUPAC Name | pentanedithioic acid;stibane |
| SMILES | CCCCC(=S)S.[SbH3] |
| InChI | InChI=1S/C5H10S2.Sb.3H/c1-2-3-4-5(6)7;;;;/h2-4H2,1H3,(H,6,7);;;; |
| InChIKey | RJJWNIYNTZLBCO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.05 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze pentanedithioic acid;stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanedithioic acid;stibane?
The IUPAC name of pentanedithioic acid;stibane (CID 174261271) is pentanedithioic acid;stibane.
What is the SMILES notation for pentanedithioic acid;stibane?
The canonical SMILES for pentanedithioic acid;stibane is CCCCC(=S)S.[SbH3].
What is the InChIKey of pentanedithioic acid;stibane?
The InChIKey is RJJWNIYNTZLBCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10S2.Sb.3H/c1-2-3-4-5(6)7;;;;/h2-4H2,1H3,(H,6,7);;;;.
What are the key properties of pentanedithioic acid;stibane?
pentanedithioic acid;stibane has a molecular weight of 259.05 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentanedithioic acid;stibane is sourced from PubChem (CID 174261271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).