C12H22S2 — CID 87361196
2,3-bis(butylsulfanyl)buta-1,3-diene (PubChem CID 87361196) has the molecular formula C12H22S2 and a molecular weight of 230.44 g/mol. Its IUPAC name is 2,3-bis(butylsulfanyl)buta-1,3-diene.
| Compound Name | 2,3-bis(butylsulfanyl)buta-1,3-diene |
|---|---|
| PubChem CID | 87361196 |
| Molecular Formula | C12H22S2 |
| Molecular Weight | 230.44 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2,3-bis(butylsulfanyl)buta-1,3-diene |
| SMILES | C=C(SCCCC)C(=C)SCCCC |
| InChI | InChI=1S/C12H22S2/c1-5-7-9-13-11(3)12(4)14-10-8-6-2/h3-10H2,1-2H3 |
| InChIKey | XUOOIYBVRVFKMY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|