C9H15F3N2OS2 — CID 106428805
2-carbamothioyl-N-[2-(trifluoromethylsulfanyl)ethyl]pentanamide (PubChem CID 106428805) has the molecular formula C9H15F3N2OS2 and a molecular weight of 288.36 g/mol. Its IUPAC name is 2-carbamothioyl-N-[2-(trifluoromethylsulfanyl)ethyl]pentanamide.
| Compound Name | 2-carbamothioyl-N-[2-(trifluoromethylsulfanyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 106428805 |
| Molecular Formula | C9H15F3N2OS2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-carbamothioyl-N-[2-(trifluoromethylsulfanyl)ethyl]pentanamide |
| SMILES | CCCC(C(=O)NCCSC(F)(F)F)C(N)=S |
| InChI | InChI=1S/C9H15F3N2OS2/c1-2-3-6(7(13)16)8(15)14-4-5-17-9(10,11)12/h6H,2-5H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | KVRKSHJDADGIFU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|