About 2-bromo-3-iodohexane
2-bromo-3-iodohexane (PubChem CID 54541295) has the molecular formula C6H12BrI
and a molecular weight of 290.97 g/mol. Its IUPAC name is 2-bromo-3-iodohexane.
Molecular Properties
| Compound Name | 2-bromo-3-iodohexane |
| PubChem CID | 54541295 |
| Molecular Formula | C6H12BrI |
| Molecular Weight | 290.97 g/mol |
| Exact Mass | 289.92 |
| IUPAC Name | 2-bromo-3-iodohexane |
| SMILES | CCCC(I)C(C)Br |
| InChI | InChI=1S/C6H12BrI/c1-3-4-6(8)5(2)7/h5-6H,3-4H2,1-2H3 |
| InChIKey | BFSDZMASRJHGAJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.97 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-iodohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-iodohexane?
The IUPAC name of 2-bromo-3-iodohexane (CID 54541295) is 2-bromo-3-iodohexane.
What is the SMILES notation for 2-bromo-3-iodohexane?
The canonical SMILES for 2-bromo-3-iodohexane is CCCC(I)C(C)Br.
What is the InChIKey of 2-bromo-3-iodohexane?
The InChIKey is BFSDZMASRJHGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12BrI/c1-3-4-6(8)5(2)7/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-bromo-3-iodohexane?
2-bromo-3-iodohexane has a molecular weight of 290.97 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-iodohexane is sourced from PubChem (CID 54541295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).