About 2,3-dibromoheptan-4-ol
2,3-dibromoheptan-4-ol (PubChem CID 18920995) has the molecular formula C7H14Br2O
and a molecular weight of 274.00 g/mol. Its IUPAC name is 2,3-dibromoheptan-4-ol.
Molecular Properties
| Compound Name | 2,3-dibromoheptan-4-ol |
| PubChem CID | 18920995 |
| Molecular Formula | C7H14Br2O |
| Molecular Weight | 274.00 g/mol |
| Exact Mass | 271.94 |
| IUPAC Name | 2,3-dibromoheptan-4-ol |
| SMILES | CCCC(O)C(Br)C(C)Br |
| InChI | InChI=1S/C7H14Br2O/c1-3-4-6(10)7(9)5(2)8/h5-7,10H,3-4H2,1-2H3 |
| InChIKey | NVYNTJDZWOIESW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.00 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibromoheptan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromoheptan-4-ol?
The IUPAC name of 2,3-dibromoheptan-4-ol (CID 18920995) is 2,3-dibromoheptan-4-ol.
What is the SMILES notation for 2,3-dibromoheptan-4-ol?
The canonical SMILES for 2,3-dibromoheptan-4-ol is CCCC(O)C(Br)C(C)Br.
What is the InChIKey of 2,3-dibromoheptan-4-ol?
The InChIKey is NVYNTJDZWOIESW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14Br2O/c1-3-4-6(10)7(9)5(2)8/h5-7,10H,3-4H2,1-2H3.
What are the key properties of 2,3-dibromoheptan-4-ol?
2,3-dibromoheptan-4-ol has a molecular weight of 274.00 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromoheptan-4-ol is sourced from PubChem (CID 18920995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).