About azane;3-bromohexan-2-ol
azane;3-bromohexan-2-ol (PubChem CID 174944602) has the molecular formula C6H16BrNO
and a molecular weight of 198.10 g/mol. Its IUPAC name is azane;3-bromohexan-2-ol.
Molecular Properties
| Compound Name | azane;3-bromohexan-2-ol |
| PubChem CID | 174944602 |
| Molecular Formula | C6H16BrNO |
| Molecular Weight | 198.10 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | azane;3-bromohexan-2-ol |
| SMILES | CCCC(Br)C(C)O.N |
| InChI | InChI=1S/C6H13BrO.H3N/c1-3-4-6(7)5(2)8;/h5-6,8H,3-4H2,1-2H3;1H3 |
| InChIKey | NZYPLSZLJHVBPE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.10 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;3-bromohexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-bromohexan-2-ol?
The IUPAC name of azane;3-bromohexan-2-ol (CID 174944602) is azane;3-bromohexan-2-ol.
What is the SMILES notation for azane;3-bromohexan-2-ol?
The canonical SMILES for azane;3-bromohexan-2-ol is CCCC(Br)C(C)O.N.
What is the InChIKey of azane;3-bromohexan-2-ol?
The InChIKey is NZYPLSZLJHVBPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13BrO.H3N/c1-3-4-6(7)5(2)8;/h5-6,8H,3-4H2,1-2H3;1H3.
What are the key properties of azane;3-bromohexan-2-ol?
azane;3-bromohexan-2-ol has a molecular weight of 198.10 g/mol, XLogP of 2.09, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-bromohexan-2-ol is sourced from PubChem (CID 174944602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).