About hexane-2,3-diol
hexane-2,3-diol (PubChem CID 159913798) has the molecular formula C12H28O4
and a molecular weight of 236.35 g/mol. Its IUPAC name is hexane-2,3-diol.
Molecular Properties
| Compound Name | hexane-2,3-diol |
| PubChem CID | 159913798 |
| Molecular Formula | C12H28O4 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | hexane-2,3-diol |
| SMILES | CCCC(O)C(C)O.CCCC(O)C(C)O |
| InChI | InChI=1S/2C6H14O2/c2*1-3-4-6(8)5(2)7/h2*5-8H,3-4H2,1-2H3 |
| InChIKey | NXNBGFCWLISHHS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze hexane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-2,3-diol?
The IUPAC name of hexane-2,3-diol (CID 159913798) is hexane-2,3-diol.
What is the SMILES notation for hexane-2,3-diol?
The canonical SMILES for hexane-2,3-diol is CCCC(O)C(C)O.CCCC(O)C(C)O.
What is the InChIKey of hexane-2,3-diol?
The InChIKey is NXNBGFCWLISHHS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H14O2/c2*1-3-4-6(8)5(2)7/h2*5-8H,3-4H2,1-2H3.
What are the key properties of hexane-2,3-diol?
hexane-2,3-diol has a molecular weight of 236.35 g/mol, XLogP of 1.06, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-2,3-diol is sourced from PubChem (CID 159913798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).