About octane-4,5-diol;hydrate
octane-4,5-diol;hydrate (PubChem CID 141056272) has the molecular formula C8H20O3
and a molecular weight of 164.24 g/mol. Its IUPAC name is octane-4,5-diol;hydrate.
Molecular Properties
| Compound Name | octane-4,5-diol;hydrate |
| PubChem CID | 141056272 |
| Molecular Formula | C8H20O3 |
| Molecular Weight | 164.24 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | octane-4,5-diol;hydrate |
| SMILES | CCCC(O)C(O)CCC.O |
| InChI | InChI=1S/C8H18O2.H2O/c1-3-5-7(9)8(10)6-4-2;/h7-10H,3-6H2,1-2H3;1H2 |
| InChIKey | WWFVECWKXCUKJA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze octane-4,5-diol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane-4,5-diol;hydrate?
The IUPAC name of octane-4,5-diol;hydrate (CID 141056272) is octane-4,5-diol;hydrate.
What is the SMILES notation for octane-4,5-diol;hydrate?
The canonical SMILES for octane-4,5-diol;hydrate is CCCC(O)C(O)CCC.O.
What is the InChIKey of octane-4,5-diol;hydrate?
The InChIKey is WWFVECWKXCUKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2.H2O/c1-3-5-7(9)8(10)6-4-2;/h7-10H,3-6H2,1-2H3;1H2.
What are the key properties of octane-4,5-diol;hydrate?
octane-4,5-diol;hydrate has a molecular weight of 164.24 g/mol, XLogP of 0.48, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octane-4,5-diol;hydrate is sourced from PubChem (CID 141056272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).