About octane-2,3-diol;hydrochloride
octane-2,3-diol;hydrochloride (PubChem CID 175007054) has the molecular formula C8H19ClO2
and a molecular weight of 182.69 g/mol. Its IUPAC name is octane-2,3-diol;hydrochloride.
Molecular Properties
| Compound Name | octane-2,3-diol;hydrochloride |
| PubChem CID | 175007054 |
| Molecular Formula | C8H19ClO2 |
| Molecular Weight | 182.69 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | octane-2,3-diol;hydrochloride |
| SMILES | CCCCCC(O)C(C)O.Cl |
| InChI | InChI=1S/C8H18O2.ClH/c1-3-4-5-6-8(10)7(2)9;/h7-10H,3-6H2,1-2H3;1H |
| InChIKey | ZADWXDBCUWHWTN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.69 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octane-2,3-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane-2,3-diol;hydrochloride?
The IUPAC name of octane-2,3-diol;hydrochloride (CID 175007054) is octane-2,3-diol;hydrochloride.
What is the SMILES notation for octane-2,3-diol;hydrochloride?
The canonical SMILES for octane-2,3-diol;hydrochloride is CCCCCC(O)C(C)O.Cl.
What is the InChIKey of octane-2,3-diol;hydrochloride?
The InChIKey is ZADWXDBCUWHWTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2.ClH/c1-3-4-5-6-8(10)7(2)9;/h7-10H,3-6H2,1-2H3;1H.
What are the key properties of octane-2,3-diol;hydrochloride?
octane-2,3-diol;hydrochloride has a molecular weight of 182.69 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octane-2,3-diol;hydrochloride is sourced from PubChem (CID 175007054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).