C17H36O3 — CID 90443080
heptadecane-2,5,6-triol (PubChem CID 90443080) has the molecular formula C17H36O3 and a molecular weight of 288.47 g/mol. Its IUPAC name is heptadecane-2,5,6-triol.
| Compound Name | heptadecane-2,5,6-triol |
|---|---|
| PubChem CID | 90443080 |
| Molecular Formula | C17H36O3 |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.27 |
| IUPAC Name | heptadecane-2,5,6-triol |
| SMILES | CCCCCCCCCCCC(O)C(O)CCC(C)O |
| InChI | InChI=1S/C17H36O3/c1-3-4-5-6-7-8-9-10-11-12-16(19)17(20)14-13-15(2)18/h15-20H,3-14H2,1-2H3 |
| InChIKey | KNBWCINTRKSZTG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|