C20H42O3 — CID 90443113
icosane-2,5,6-triol (PubChem CID 90443113) has the molecular formula C20H42O3 and a molecular weight of 330.55 g/mol. Its IUPAC name is icosane-2,5,6-triol.
| Compound Name | icosane-2,5,6-triol |
|---|---|
| PubChem CID | 90443113 |
| Molecular Formula | C20H42O3 |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 330.31 |
| IUPAC Name | icosane-2,5,6-triol |
| SMILES | CCCCCCCCCCCCCCC(O)C(O)CCC(C)O |
| InChI | InChI=1S/C20H42O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)20(23)17-16-18(2)21/h18-23H,3-17H2,1-2H3 |
| InChIKey | JMBMWEBBLWMGBA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|