C17H36O4 — CID 175167474
acetic acid;pentadecane-2,3-diol (PubChem CID 175167474) has the molecular formula C17H36O4 and a molecular weight of 304.47 g/mol. Its IUPAC name is acetic acid;pentadecane-2,3-diol.
| Compound Name | acetic acid;pentadecane-2,3-diol |
|---|---|
| PubChem CID | 175167474 |
| Molecular Formula | C17H36O4 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | acetic acid;pentadecane-2,3-diol |
| SMILES | CC(=O)O.CCCCCCCCCCCCC(O)C(C)O |
| InChI | InChI=1S/C15H32O2.C2H4O2/c1-3-4-5-6-7-8-9-10-11-12-13-15(17)14(2)16;1-2(3)4/h14-17H,3-13H2,1-2H3;1H3,(H,3,4) |
| InChIKey | NHKRIBZZMFYJRK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|