acetic acid;pentadecane-2,3-diol

C17H36O4 — CID 175167474

IUPACacetic acid;pentadecane-2,3-diol
SMILESCC(=O)O.CCCCCCCCCCCCC(O)C(C)O
InChIInChI=1S/C15H32O2.C2H4O2/c1-3-4-5-6-7-8-9-10-11-12-13-15(17)14(2)16;1-2(3)4/h14-17H,3-13H2,1-2H3;1H3,(H,3,4)
InChIKeyNHKRIBZZMFYJRK-UHFFFAOYSA-N
MW304.47 g/mol
LogP4.13
Rot. Bonds12

About acetic acid;pentadecane-2,3-diol

acetic acid;pentadecane-2,3-diol (PubChem CID 175167474) has the molecular formula C17H36O4 and a molecular weight of 304.47 g/mol. Its IUPAC name is acetic acid;pentadecane-2,3-diol.

Molecular Properties

Compound Nameacetic acid;pentadecane-2,3-diol
PubChem CID175167474
Molecular FormulaC17H36O4
Molecular Weight304.47 g/mol
Exact Mass304.26
IUPAC Nameacetic acid;pentadecane-2,3-diol
SMILESCC(=O)O.CCCCCCCCCCCCC(O)C(C)O
InChIInChI=1S/C15H32O2.C2H4O2/c1-3-4-5-6-7-8-9-10-11-12-13-15(17)14(2)16;1-2(3)4/h14-17H,3-13H2,1-2H3;1H3,(H,3,4)
InChIKeyNHKRIBZZMFYJRK-UHFFFAOYSA-N
XLogP4.13
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds12
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.47
LogP ≤ 54.13
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze acetic acid;pentadecane-2,3-diol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;pentadecane-2,3-diol?
The IUPAC name of acetic acid;pentadecane-2,3-diol (CID 175167474) is acetic acid;pentadecane-2,3-diol.
What is the SMILES notation for acetic acid;pentadecane-2,3-diol?
The canonical SMILES for acetic acid;pentadecane-2,3-diol is CC(=O)O.CCCCCCCCCCCCC(O)C(C)O.
What is the InChIKey of acetic acid;pentadecane-2,3-diol?
The InChIKey is NHKRIBZZMFYJRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O2.C2H4O2/c1-3-4-5-6-7-8-9-10-11-12-13-15(17)14(2)16;1-2(3)4/h14-17H,3-13H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;pentadecane-2,3-diol?
acetic acid;pentadecane-2,3-diol has a molecular weight of 304.47 g/mol, XLogP of 4.13, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;pentadecane-2,3-diol is sourced from PubChem (CID 175167474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).