C6H2Cl12O — CID 87603621
1,2,2,3,3,4,4,5,5,6,6,6-dodecachlorohexan-1-ol (PubChem CID 87603621) has the molecular formula C6H2Cl12O and a molecular weight of 515.52 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,6-dodecachlorohexan-1-ol.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,6-dodecachlorohexan-1-ol |
|---|---|
| PubChem CID | 87603621 |
| Molecular Formula | C6H2Cl12O |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 509.64 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,6-dodecachlorohexan-1-ol |
| SMILES | OC(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H2Cl12O/c7-1(19)2(8,9)3(10,11)4(12,13)5(14,15)6(16,17)18/h1,19H |
| InChIKey | FHQQXQQBQOPNRT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|