C14H9Cl17O2 — CID 173325255
5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecachloro-2,4-dimethyldodec-2-enoic acid (PubChem CID 173325255) has the molecular formula C14H9Cl17O2 and a molecular weight of 811.92 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecachloro-2,4-dimethyldodec-2-enoic acid.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecachloro-2,4-dimethyldodec-2-enoic acid |
|---|---|
| PubChem CID | 173325255 |
| Molecular Formula | C14H9Cl17O2 |
| Molecular Weight | 811.92 g/mol |
| Exact Mass | 803.53 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecachloro-2,4-dimethyldodec-2-enoic acid |
| SMILES | CC(=CC(C)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C14H9Cl17O2/c1-4(6(32)33)3-5(2)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h3,5H,1-2H3,(H,32,33) |
| InChIKey | AXUKGWUJYUWTHG-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.92 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|