5-hydroxy-2,4-dimethylhex-2-enoic acid

C8H14O3 — CID 54037890

IUPAC5-hydroxy-2,4-dimethylhex-2-enoic acid
SMILESCC(=CC(C)C(C)O)C(=O)O
InChIInChI=1S/C8H14O3/c1-5(7(3)9)4-6(2)8(10)11/h4-5,7,9H,1-3H3,(H,10,11)
InChIKeyLKGJTWKCPAFFMT-UHFFFAOYSA-N
MW158.20 g/mol
LogP1.03
Rot. Bonds3

About 5-hydroxy-2,4-dimethylhex-2-enoic acid

5-hydroxy-2,4-dimethylhex-2-enoic acid (PubChem CID 54037890) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 5-hydroxy-2,4-dimethylhex-2-enoic acid.

Molecular Properties

Compound Name5-hydroxy-2,4-dimethylhex-2-enoic acid
PubChem CID54037890
Molecular FormulaC8H14O3
Molecular Weight158.20 g/mol
Exact Mass158.09
IUPAC Name5-hydroxy-2,4-dimethylhex-2-enoic acid
SMILESCC(=CC(C)C(C)O)C(=O)O
InChIInChI=1S/C8H14O3/c1-5(7(3)9)4-6(2)8(10)11/h4-5,7,9H,1-3H3,(H,10,11)
InChIKeyLKGJTWKCPAFFMT-UHFFFAOYSA-N
XLogP1.03
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.20
LogP ≤ 51.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 5-hydroxy-2,4-dimethylhex-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-hydroxy-2,4-dimethylhex-2-enoic acid?
The IUPAC name of 5-hydroxy-2,4-dimethylhex-2-enoic acid (CID 54037890) is 5-hydroxy-2,4-dimethylhex-2-enoic acid.
What is the SMILES notation for 5-hydroxy-2,4-dimethylhex-2-enoic acid?
The canonical SMILES for 5-hydroxy-2,4-dimethylhex-2-enoic acid is CC(=CC(C)C(C)O)C(=O)O.
What is the InChIKey of 5-hydroxy-2,4-dimethylhex-2-enoic acid?
The InChIKey is LKGJTWKCPAFFMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-5(7(3)9)4-6(2)8(10)11/h4-5,7,9H,1-3H3,(H,10,11).
What are the key properties of 5-hydroxy-2,4-dimethylhex-2-enoic acid?
5-hydroxy-2,4-dimethylhex-2-enoic acid has a molecular weight of 158.20 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2,4-dimethylhex-2-enoic acid is sourced from PubChem (CID 54037890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).