C6H10Br2O — CID 88935877
(2S,3R)-5,5-dibromo-3-methylpent-4-en-2-ol (PubChem CID 88935877) has the molecular formula C6H10Br2O and a molecular weight of 257.95 g/mol. Its IUPAC name is (2S,3R)-5,5-dibromo-3-methylpent-4-en-2-ol.
| Compound Name | (2S,3R)-5,5-dibromo-3-methylpent-4-en-2-ol |
|---|---|
| PubChem CID | 88935877 |
| Molecular Formula | C6H10Br2O |
| Molecular Weight | 257.95 g/mol |
| Exact Mass | 255.91 |
| IUPAC Name | (2S,3R)-5,5-dibromo-3-methylpent-4-en-2-ol |
| SMILES | C[C@H](O)[C@H](C)C=C(Br)Br |
| InChI | InChI=1S/C6H10Br2O/c1-4(5(2)9)3-6(7)8/h3-5,9H,1-2H3/t4-,5+/m1/s1 |
| InChIKey | NUUWQTPVFGZYJP-UHNVWZDZSA-N |
| XLogP | 2.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.95 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |