C7H12Br2O3 — CID 59169163
(3S,4R,5R)-1,1-dibromohept-1-ene-3,4,5-triol (PubChem CID 59169163) has the molecular formula C7H12Br2O3 and a molecular weight of 303.98 g/mol. Its IUPAC name is (3S,4R,5R)-1,1-dibromohept-1-ene-3,4,5-triol.
| Compound Name | (3S,4R,5R)-1,1-dibromohept-1-ene-3,4,5-triol |
|---|---|
| PubChem CID | 59169163 |
| Molecular Formula | C7H12Br2O3 |
| Molecular Weight | 303.98 g/mol |
| Exact Mass | 301.92 |
| IUPAC Name | (3S,4R,5R)-1,1-dibromohept-1-ene-3,4,5-triol |
| SMILES | CC[C@@H](O)[C@@H](O)[C@@H](O)C=C(Br)Br |
| InChI | InChI=1S/C7H12Br2O3/c1-2-4(10)7(12)5(11)3-6(8)9/h3-5,7,10-12H,2H2,1H3/t4-,5+,7-/m1/s1 |
| InChIKey | VMGOOBWVLSVTLQ-JCGDXUMPSA-N |
| XLogP | 1.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.98 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |