C4H3Cl7O2 — CID 154510246
1,1,2,2,3,3,4-heptachlorobutane-1,4-diol (PubChem CID 154510246) has the molecular formula C4H3Cl7O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptachlorobutane-1,4-diol.
| Compound Name | 1,1,2,2,3,3,4-heptachlorobutane-1,4-diol |
|---|---|
| PubChem CID | 154510246 |
| Molecular Formula | C4H3Cl7O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 327.80 |
| IUPAC Name | 1,1,2,2,3,3,4-heptachlorobutane-1,4-diol |
| SMILES | OC(Cl)C(Cl)(Cl)C(Cl)(Cl)C(O)(Cl)Cl |
| InChI | InChI=1S/C4H3Cl7O2/c5-1(12)2(6,7)3(8,9)4(10,11)13/h1,12-13H |
| InChIKey | HAKNKNTYCRTLSH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|