C2H4Cl3OSb — CID 174830796
1,2,2-trichloro-2-stibanylethanol (PubChem CID 174830796) has the molecular formula C2H4Cl3OSb and a molecular weight of 272.17 g/mol. Its IUPAC name is 1,2,2-trichloro-2-stibanylethanol.
| Compound Name | 1,2,2-trichloro-2-stibanylethanol |
|---|---|
| PubChem CID | 174830796 |
| Molecular Formula | C2H4Cl3OSb |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 269.84 |
| IUPAC Name | 1,2,2-trichloro-2-stibanylethanol |
| SMILES | OC(Cl)C(Cl)(Cl)[SbH2] |
| InChI | InChI=1S/C2H2Cl3O.Sb.2H/c3-1(4)2(5)6;;;/h2,6H;;; |
| InChIKey | OMVZKCVCKKCRHE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|