C17HCl36O3S- — CID 174515956
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-hexatriacontachloroheptadecane;hydrogen sulfite (PubChem CID 174515956) has the molecular formula C17HCl36O3S- and a molecular weight of 1561.57 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-hexatriacontachloroheptadecane;hydrogen sulfite.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-hexatriacontachloroheptadecane;hydrogen sulfite |
|---|---|
| PubChem CID | 174515956 |
| Molecular Formula | C17HCl36O3S- |
| Molecular Weight | 1561.57 g/mol |
| Exact Mass | 1543.84 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-hexatriacontachloroheptadecane;hydrogen sulfite |
| SMILES | ClC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl.O=S([O-])O |
| InChI | InChI=1S/C17Cl36.H2O3S/c18-1(19,2(20,21)4(24,25)6(28,29)8(32,33)10(36,37)12(40,41)14(44,45)16(48,49)50)3(22,23)5(26,27)7(30,31)9(34,35)11(38,39)13(42,43)15(46,47)17(51,52)53;1-4(2)3/h;(H2,1,2,3)/p-1 |
| InChIKey | ZDJSIQIRMZGOCV-UHFFFAOYSA-M |
| XLogP | 20.67 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1561.57 |
| LogP ≤ 5 | 20.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|