C20Cl40 — CID 88923236
1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-tetracontachloroicos-1-ene (PubChem CID 88923236) has the molecular formula C20Cl40 and a molecular weight of 1658.34 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-tetracontachloroicos-1-ene.
| Compound Name | 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-tetracontachloroicos-1-ene |
|---|---|
| PubChem CID | 88923236 |
| Molecular Formula | C20Cl40 |
| Molecular Weight | 1658.34 g/mol |
| Exact Mass | 1638.75 |
| IUPAC Name | 1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-tetracontachloroicos-1-ene |
| SMILES | ClC(Cl)=C(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20Cl40/c21-1(2(22)23)3(24,25)4(26,27)5(28,29)6(30,31)7(32,33)8(34,35)9(36,37)10(38,39)11(40,41)12(42,43)13(44,45)14(46,47)15(48,49)16(50,51)17(52,53)18(54,55)19(56,57)20(58,59)60 |
| InChIKey | UNPLTGHYLLTMCJ-UHFFFAOYSA-N |
| XLogP | 24.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1658.34 |
| LogP ≤ 5 | 24.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|