C14HCl25O2 — CID 172719134
4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecachloro-3-(1,1,2,2,2-pentachloroethyl)-2-(trichloromethyl)undec-2-enoic acid (PubChem CID 172719134) has the molecular formula C14HCl25O2 and a molecular weight of 1087.48 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecachloro-3-(1,1,2,2,2-pentachloroethyl)-2-(trichloromethyl)undec-2-enoic acid.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecachloro-3-(1,1,2,2,2-pentachloroethyl)-2-(trichloromethyl)undec-2-enoic acid |
|---|---|
| PubChem CID | 172719134 |
| Molecular Formula | C14HCl25O2 |
| Molecular Weight | 1087.48 g/mol |
| Exact Mass | 1075.22 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecachloro-3-(1,1,2,2,2-pentachloroethyl)-2-(trichloromethyl)undec-2-enoic acid |
| SMILES | O=C(O)C(=C(C(Cl)(Cl)C(Cl)(Cl)Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14HCl25O2/c15-4(16,2(5(17,18)13(34,35)36)1(3(40)41)6(19,20)21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)12(32,33)14(37,38)39/h(H,40,41) |
| InChIKey | GGOFEIISUKKKHP-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.48 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|