C8Cl14O3 — CID 130331707
2,2,3,3,4,4,4-heptachlorobutanoyl 2,2,3,3,4,4,4-heptachlorobutanoate (PubChem CID 130331707) has the molecular formula C8Cl14O3 and a molecular weight of 640.43 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptachlorobutanoyl 2,2,3,3,4,4,4-heptachlorobutanoate.
| Compound Name | 2,2,3,3,4,4,4-heptachlorobutanoyl 2,2,3,3,4,4,4-heptachlorobutanoate |
|---|---|
| PubChem CID | 130331707 |
| Molecular Formula | C8Cl14O3 |
| Molecular Weight | 640.43 g/mol |
| Exact Mass | 633.55 |
| IUPAC Name | 2,2,3,3,4,4,4-heptachlorobutanoyl 2,2,3,3,4,4,4-heptachlorobutanoate |
| SMILES | O=C(OC(=O)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8Cl14O3/c9-3(10,5(13,14)7(17,18)19)1(23)25-2(24)4(11,12)6(15,16)8(20,21)22 |
| InChIKey | VYQMRJCRBNRPTC-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.43 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|