C4Cl2F4O4 — CID 174892159
difluoro 2,2-dichloro-3,3-difluorobutanedioate (PubChem CID 174892159) has the molecular formula C4Cl2F4O4 and a molecular weight of 258.94 g/mol. Its IUPAC name is difluoro 2,2-dichloro-3,3-difluorobutanedioate.
| Compound Name | difluoro 2,2-dichloro-3,3-difluorobutanedioate |
|---|---|
| PubChem CID | 174892159 |
| Molecular Formula | C4Cl2F4O4 |
| Molecular Weight | 258.94 g/mol |
| Exact Mass | 257.91 |
| IUPAC Name | difluoro 2,2-dichloro-3,3-difluorobutanedioate |
| SMILES | O=C(OF)C(F)(F)C(Cl)(Cl)C(=O)OF |
| InChI | InChI=1S/C4Cl2F4O4/c5-3(6,1(11)13-9)4(7,8)2(12)14-10 |
| InChIKey | WFMHTAVNGXVBPO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.94 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|