C3H2F5KO2 — CID 173393636
potassium;fluoro 2,2,3,3-tetrafluoropropanoate;hydride (PubChem CID 173393636) has the molecular formula C3H2F5KO2 and a molecular weight of 204.14 g/mol. Its IUPAC name is potassium;fluoro 2,2,3,3-tetrafluoropropanoate;hydride.
| Compound Name | potassium;fluoro 2,2,3,3-tetrafluoropropanoate;hydride |
|---|---|
| PubChem CID | 173393636 |
| Molecular Formula | C3H2F5KO2 |
| Molecular Weight | 204.14 g/mol |
| Exact Mass | 203.96 |
| IUPAC Name | potassium;fluoro 2,2,3,3-tetrafluoropropanoate;hydride |
| SMILES | O=C(OF)C(F)(F)C(F)F.[H-].[K+] |
| InChI | InChI=1S/C3HF5O2.K.H/c4-1(5)3(6,7)2(9)10-8;;/h1H;;/q;+1;-1 |
| InChIKey | GPXDYLFNLLVYRV-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.14 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|