C6HF9O3 — CID 59114952
fluoro 2,3,3,3-tetrafluoro-2-[(E)-1,2,3,3-tetrafluoroprop-1-enoxy]propanoate (PubChem CID 59114952) has the molecular formula C6HF9O3 and a molecular weight of 292.05 g/mol. Its IUPAC name is fluoro 2,3,3,3-tetrafluoro-2-[(E)-1,2,3,3-tetrafluoroprop-1-enoxy]propanoate.
| Compound Name | fluoro 2,3,3,3-tetrafluoro-2-[(E)-1,2,3,3-tetrafluoroprop-1-enoxy]propanoate |
|---|---|
| PubChem CID | 59114952 |
| Molecular Formula | C6HF9O3 |
| Molecular Weight | 292.05 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | fluoro 2,3,3,3-tetrafluoro-2-[(E)-1,2,3,3-tetrafluoroprop-1-enoxy]propanoate |
| SMILES | O=C(OF)C(F)(O/C(F)=C(\F)C(F)F)C(F)(F)F |
| InChI | InChI=1S/C6HF9O3/c7-1(2(8)9)3(10)17-5(11,4(16)18-15)6(12,13)14/h2H/b3-1- |
| InChIKey | XUIWRIVQPQBMSM-IWQZZHSRSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.05 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|