C4CuF6O3 — CID 87233917
copper;fluoro 2,2,4,4,4-pentafluoro-3-oxobutanoate (PubChem CID 87233917) has the molecular formula C4CuF6O3 and a molecular weight of 273.57 g/mol. Its IUPAC name is copper;fluoro 2,2,4,4,4-pentafluoro-3-oxobutanoate.
| Compound Name | copper;fluoro 2,2,4,4,4-pentafluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 87233917 |
| Molecular Formula | C4CuF6O3 |
| Molecular Weight | 273.57 g/mol |
| Exact Mass | 272.90 |
| IUPAC Name | copper;fluoro 2,2,4,4,4-pentafluoro-3-oxobutanoate |
| SMILES | O=C(OF)C(F)(F)C(=O)C(F)(F)F.[Cu] |
| InChI | InChI=1S/C4F6O3.Cu/c5-3(6,2(12)13-10)1(11)4(7,8)9; |
| InChIKey | CTMLMLMAUPWYEE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.57 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|