C4H2F6O3 — CID 58623366
2-(difluoromethoxy)-2,3,3,3-tetrafluoropropanoic acid (PubChem CID 58623366) has the molecular formula C4H2F6O3 and a molecular weight of 212.05 g/mol. Its IUPAC name is 2-(difluoromethoxy)-2,3,3,3-tetrafluoropropanoic acid.
| Compound Name | 2-(difluoromethoxy)-2,3,3,3-tetrafluoropropanoic acid |
|---|---|
| PubChem CID | 58623366 |
| Molecular Formula | C4H2F6O3 |
| Molecular Weight | 212.05 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 2-(difluoromethoxy)-2,3,3,3-tetrafluoropropanoic acid |
| SMILES | O=C(O)C(F)(OC(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H2F6O3/c5-2(6)13-3(7,1(11)12)4(8,9)10/h2H,(H,11,12) |
| InChIKey | OSDKWKKECLDUIM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.05 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |