About 2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride
2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride (PubChem CID 88623979) has the molecular formula C6H9ClF4O3
and a molecular weight of 240.58 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride.
Analyze 2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride?
The IUPAC name of 2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride (CID 88623979) is 2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride.
What is the SMILES notation for 2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride?
The canonical SMILES for 2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride is CCCOC(F)(C(=O)O)C(F)(F)F.Cl.
What is the InChIKey of 2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride?
The InChIKey is FFTGZTFHUPUHQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F4O3.ClH/c1-2-3-13-5(7,4(11)12)6(8,9)10;/h2-3H2,1H3,(H,11,12);1H.
What are the key properties of 2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride?
2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride has a molecular weight of 240.58 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3,3-tetrafluoro-2-propoxypropanoic acid;hydrochloride is sourced from PubChem (CID 88623979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).