About 1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride
1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride (PubChem CID 18400465) has the molecular formula C5H7F5O3S
and a molecular weight of 242.16 g/mol. Its IUPAC name is 1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride.
Analyze 1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride?
The IUPAC name of 1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride (CID 18400465) is 1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride.
What is the SMILES notation for 1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride?
The canonical SMILES for 1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride is CCCOC(F)(C(F)(F)F)S(=O)(=O)F.
What is the InChIKey of 1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride?
The InChIKey is OFWSQASQONLASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F5O3S/c1-2-3-13-5(9,4(6,7)8)14(10,11)12/h2-3H2,1H3.
What are the key properties of 1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride?
1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride has a molecular weight of 242.16 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2,2-tetrafluoro-1-propoxyethanesulfonyl fluoride is sourced from PubChem (CID 18400465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).