C5H3F7O2 — CID 134247680
2,2,2-trifluoroethyl 2,2,3,3-tetrafluoropropanoate (PubChem CID 134247680) has the molecular formula C5H3F7O2 and a molecular weight of 228.06 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2,2,3,3-tetrafluoropropanoate.
| Compound Name | 2,2,2-trifluoroethyl 2,2,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 134247680 |
| Molecular Formula | C5H3F7O2 |
| Molecular Weight | 228.06 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 2,2,2-trifluoroethyl 2,2,3,3-tetrafluoropropanoate |
| SMILES | O=C(OCC(F)(F)F)C(F)(F)C(F)F |
| InChI | InChI=1S/C5H3F7O2/c6-2(7)5(11,12)3(13)14-1-4(8,9)10/h2H,1H2 |
| InChIKey | WKYNFTVQBRFEHW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.06 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|