About 2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate
2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate (PubChem CID 139170506) has the molecular formula C7H11F3O5
and a molecular weight of 232.15 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate.
Analyze 2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate?
The IUPAC name of 2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate (CID 139170506) is 2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate.
What is the SMILES notation for 2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate?
The canonical SMILES for 2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate is O=C(OCC(F)(F)F)C(CO)(CO)CO.
What is the InChIKey of 2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate?
The InChIKey is PLJGIXHRNHYTAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3O5/c8-7(9,10)4-15-5(14)6(1-11,2-12)3-13/h11-13H,1-4H2.
What are the key properties of 2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate?
2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate has a molecular weight of 232.15 g/mol, XLogP of -0.94, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl 3-hydroxy-2,2-bis(hydroxymethyl)propanoate is sourced from PubChem (CID 139170506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).