About 2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate
2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate (PubChem CID 10563131) has the molecular formula C6H2F8O2
and a molecular weight of 258.06 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate.
Analyze 2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate?
The IUPAC name of 2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate (CID 10563131) is 2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate.
What is the SMILES notation for 2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate?
The canonical SMILES for 2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate is O=C(OCC(F)(F)F)C(F)(F)C(F)=C(F)F.
What is the InChIKey of 2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate?
The InChIKey is NNZAQGGADNRJDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2F8O2/c7-2(3(8)9)6(13,14)4(15)16-1-5(10,11)12/h1H2.
What are the key properties of 2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate?
2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate has a molecular weight of 258.06 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl 2,2,3,4,4-pentafluorobut-3-enoate is sourced from PubChem (CID 10563131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).