C14H16F6O4 — CID 101259259
bis(2,2,2-trifluoroethyl) 2-[(2E,4E)-hexa-2,4-dienyl]-2-methylpropanedioate (PubChem CID 101259259) has the molecular formula C14H16F6O4 and a molecular weight of 362.27 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2-[(2E,4E)-hexa-2,4-dienyl]-2-methylpropanedioate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2-[(2E,4E)-hexa-2,4-dienyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 101259259 |
| Molecular Formula | C14H16F6O4 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2-[(2E,4E)-hexa-2,4-dienyl]-2-methylpropanedioate |
| SMILES | C/C=C/C=C/CC(C)(C(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C14H16F6O4/c1-3-4-5-6-7-12(2,10(21)23-8-13(15,16)17)11(22)24-9-14(18,19)20/h3-6H,7-9H2,1-2H3/b4-3+,6-5+ |
| InChIKey | IXSJRSDKWGNZOA-VNKDHWASSA-N |
| XLogP | 3.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|