C10H10F6O6 — CID 102282327
[(Z)-4-(2,2,2-trifluoroethoxycarbonyloxy)but-2-enyl] 2,2,2-trifluoroethyl carbonate (PubChem CID 102282327) has the molecular formula C10H10F6O6 and a molecular weight of 340.17 g/mol. Its IUPAC name is [(Z)-4-(2,2,2-trifluoroethoxycarbonyloxy)but-2-enyl] 2,2,2-trifluoroethyl carbonate.
| Compound Name | [(Z)-4-(2,2,2-trifluoroethoxycarbonyloxy)but-2-enyl] 2,2,2-trifluoroethyl carbonate |
|---|---|
| PubChem CID | 102282327 |
| Molecular Formula | C10H10F6O6 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | [(Z)-4-(2,2,2-trifluoroethoxycarbonyloxy)but-2-enyl] 2,2,2-trifluoroethyl carbonate |
| SMILES | O=C(OC/C=C\COC(=O)OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C10H10F6O6/c11-9(12,13)5-21-7(17)19-3-1-2-4-20-8(18)22-6-10(14,15)16/h1-2H,3-6H2/b2-1- |
| InChIKey | UAXZQVDFTYSEHX-UPHRSURJSA-N |
| XLogP | 2.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|