C14H21F3O4 — CID 101123820
[(Z)-3-(1-hydroxycyclobutyl)hept-2-enyl] 2,2,2-trifluoroethyl carbonate (PubChem CID 101123820) has the molecular formula C14H21F3O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is [(Z)-3-(1-hydroxycyclobutyl)hept-2-enyl] 2,2,2-trifluoroethyl carbonate.
| Compound Name | [(Z)-3-(1-hydroxycyclobutyl)hept-2-enyl] 2,2,2-trifluoroethyl carbonate |
|---|---|
| PubChem CID | 101123820 |
| Molecular Formula | C14H21F3O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [(Z)-3-(1-hydroxycyclobutyl)hept-2-enyl] 2,2,2-trifluoroethyl carbonate |
| SMILES | CCCC/C(=C/COC(=O)OCC(F)(F)F)C1(O)CCC1 |
| InChI | InChI=1S/C14H21F3O4/c1-2-3-5-11(13(19)7-4-8-13)6-9-20-12(18)21-10-14(15,16)17/h6,19H,2-5,7-10H2,1H3/b11-6- |
| InChIKey | COFZQMBKMMFYAM-WDZFZDKYSA-N |
| XLogP | 3.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|