C14H24F3NO3 — CID 102452363
2,2,2-trifluoroethyl 2-methyl-2-(octanoylamino)propanoate (PubChem CID 102452363) has the molecular formula C14H24F3NO3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-methyl-2-(octanoylamino)propanoate.
| Compound Name | 2,2,2-trifluoroethyl 2-methyl-2-(octanoylamino)propanoate |
|---|---|
| PubChem CID | 102452363 |
| Molecular Formula | C14H24F3NO3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-methyl-2-(octanoylamino)propanoate |
| SMILES | CCCCCCCC(=O)NC(C)(C)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C14H24F3NO3/c1-4-5-6-7-8-9-11(19)18-13(2,3)12(20)21-10-14(15,16)17/h4-10H2,1-3H3,(H,18,19) |
| InChIKey | DVTRLYZSIHTDFS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|