C6H2CuF8O4 — CID 160873340
copper bis(2,2,3,3-tetrafluoropropanoate) (PubChem CID 160873340) has the molecular formula C6H2CuF8O4 and a molecular weight of 353.61 g/mol. Its IUPAC name is copper bis(2,2,3,3-tetrafluoropropanoate).
| Compound Name | copper bis(2,2,3,3-tetrafluoropropanoate) |
|---|---|
| PubChem CID | 160873340 |
| Molecular Formula | C6H2CuF8O4 |
| Molecular Weight | 353.61 g/mol |
| Exact Mass | 352.91 |
| IUPAC Name | copper bis(2,2,3,3-tetrafluoropropanoate) |
| SMILES | O=C([O-])C(F)(F)C(F)F.O=C([O-])C(F)(F)C(F)F.[Cu+2] |
| InChI | InChI=1S/2C3H2F4O2.Cu/c2*4-1(5)3(6,7)2(8)9;/h2*1H,(H,8,9);/q;;+2/p-2 |
| InChIKey | SMAXSYNXLFVBSM-UHFFFAOYSA-L |
| XLogP | -0.73 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.61 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|