C6H4Cl2F4O4 — CID 58658240
bis(chloromethyl) 2,2,3,3-tetrafluorobutanedioate (PubChem CID 58658240) has the molecular formula C6H4Cl2F4O4 and a molecular weight of 286.99 g/mol. Its IUPAC name is bis(chloromethyl) 2,2,3,3-tetrafluorobutanedioate.
| Compound Name | bis(chloromethyl) 2,2,3,3-tetrafluorobutanedioate |
|---|---|
| PubChem CID | 58658240 |
| Molecular Formula | C6H4Cl2F4O4 |
| Molecular Weight | 286.99 g/mol |
| Exact Mass | 285.94 |
| IUPAC Name | bis(chloromethyl) 2,2,3,3-tetrafluorobutanedioate |
| SMILES | O=C(OCCl)C(F)(F)C(F)(F)C(=O)OCCl |
| InChI | InChI=1S/C6H4Cl2F4O4/c7-1-15-3(13)5(9,10)6(11,12)4(14)16-2-8/h1-2H2 |
| InChIKey | XRDPKRMFTMIRGX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.99 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|