C6H6Cl2F2O4 — CID 19690456
(2-chloro-2-fluoropropanoyl) 2-chloro-2-fluoropropaneperoxoate (PubChem CID 19690456) has the molecular formula C6H6Cl2F2O4 and a molecular weight of 251.01 g/mol. Its IUPAC name is (2-chloro-2-fluoropropanoyl) 2-chloro-2-fluoropropaneperoxoate.
| Compound Name | (2-chloro-2-fluoropropanoyl) 2-chloro-2-fluoropropaneperoxoate |
|---|---|
| PubChem CID | 19690456 |
| Molecular Formula | C6H6Cl2F2O4 |
| Molecular Weight | 251.01 g/mol |
| Exact Mass | 249.96 |
| IUPAC Name | (2-chloro-2-fluoropropanoyl) 2-chloro-2-fluoropropaneperoxoate |
| SMILES | CC(F)(Cl)C(=O)OOC(=O)C(C)(F)Cl |
| InChI | InChI=1S/C6H6Cl2F2O4/c1-5(7,9)3(11)13-14-4(12)6(2,8)10/h1-2H3 |
| InChIKey | XYCMDTSEKXECIB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.01 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|