C7H8ClF3O2 — CID 87523010
prop-2-enyl 2-chloro-3,3,3-trifluoro-2-methylpropanoate (PubChem CID 87523010) has the molecular formula C7H8ClF3O2 and a molecular weight of 216.59 g/mol. Its IUPAC name is prop-2-enyl 2-chloro-3,3,3-trifluoro-2-methylpropanoate.
| Compound Name | prop-2-enyl 2-chloro-3,3,3-trifluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 87523010 |
| Molecular Formula | C7H8ClF3O2 |
| Molecular Weight | 216.59 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | prop-2-enyl 2-chloro-3,3,3-trifluoro-2-methylpropanoate |
| SMILES | C=CCOC(=O)C(C)(Cl)C(F)(F)F |
| InChI | InChI=1S/C7H8ClF3O2/c1-3-4-13-5(12)6(2,8)7(9,10)11/h3H,1,4H2,2H3 |
| InChIKey | ZAKHZTDQWHENOV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.59 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|