C5Cl6O5 — CID 11068173
(2,2,2-trichloroacetyl)oxycarbonyl 2,2,2-trichloroacetate (PubChem CID 11068173) has the molecular formula C5Cl6O5 and a molecular weight of 352.77 g/mol. Its IUPAC name is (2,2,2-trichloroacetyl)oxycarbonyl 2,2,2-trichloroacetate.
| Compound Name | (2,2,2-trichloroacetyl)oxycarbonyl 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 11068173 |
| Molecular Formula | C5Cl6O5 |
| Molecular Weight | 352.77 g/mol |
| Exact Mass | 349.79 |
| IUPAC Name | (2,2,2-trichloroacetyl)oxycarbonyl 2,2,2-trichloroacetate |
| SMILES | O=C(OC(=O)C(Cl)(Cl)Cl)OC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5Cl6O5/c6-4(7,8)1(12)15-3(14)16-2(13)5(9,10)11 |
| InChIKey | QVZDIBPYMZZZDV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|