C8Cl14O — CID 173378551
1,2,3,3,4,4,4-heptachloro-1-(1,2,3,3,4,4,4-heptachlorobut-1-enoxy)but-1-ene (PubChem CID 173378551) has the molecular formula C8Cl14O and a molecular weight of 608.43 g/mol. Its IUPAC name is 1,2,3,3,4,4,4-heptachloro-1-(1,2,3,3,4,4,4-heptachlorobut-1-enoxy)but-1-ene.
| Compound Name | 1,2,3,3,4,4,4-heptachloro-1-(1,2,3,3,4,4,4-heptachlorobut-1-enoxy)but-1-ene |
|---|---|
| PubChem CID | 173378551 |
| Molecular Formula | C8Cl14O |
| Molecular Weight | 608.43 g/mol |
| Exact Mass | 601.56 |
| IUPAC Name | 1,2,3,3,4,4,4-heptachloro-1-(1,2,3,3,4,4,4-heptachlorobut-1-enoxy)but-1-ene |
| SMILES | ClC(OC(Cl)=C(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl)=C(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8Cl14O/c9-1(5(13,14)7(17,18)19)3(11)23-4(12)2(10)6(15,16)8(20,21)22 |
| InChIKey | KGHASKZHVHNSPR-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.43 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|