C8H10Cl4O — CID 88794570
(Z)-1,2-dichloro-1-[(Z)-1,2-dichlorobut-1-enoxy]but-1-ene (PubChem CID 88794570) has the molecular formula C8H10Cl4O and a molecular weight of 263.98 g/mol. Its IUPAC name is (Z)-1,2-dichloro-1-[(Z)-1,2-dichlorobut-1-enoxy]but-1-ene.
| Compound Name | (Z)-1,2-dichloro-1-[(Z)-1,2-dichlorobut-1-enoxy]but-1-ene |
|---|---|
| PubChem CID | 88794570 |
| Molecular Formula | C8H10Cl4O |
| Molecular Weight | 263.98 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | (Z)-1,2-dichloro-1-[(Z)-1,2-dichlorobut-1-enoxy]but-1-ene |
| SMILES | CC/C(Cl)=C(/Cl)O/C(Cl)=C(/Cl)CC |
| InChI | InChI=1S/C8H10Cl4O/c1-3-5(9)7(11)13-8(12)6(10)4-2/h3-4H2,1-2H3/b7-5+,8-6+ |
| InChIKey | GBYQWLSAWTXPMM-KQQUZDAGSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.98 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|