About 1,1-dichlorobut-1-en-2-yl acetate
1,1-dichlorobut-1-en-2-yl acetate (PubChem CID 88784840) has the molecular formula C6H8Cl2O2
and a molecular weight of 183.03 g/mol. Its IUPAC name is 1,1-dichlorobut-1-en-2-yl acetate.
Molecular Properties
| Compound Name | 1,1-dichlorobut-1-en-2-yl acetate |
| PubChem CID | 88784840 |
| Molecular Formula | C6H8Cl2O2 |
| Molecular Weight | 183.03 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | 1,1-dichlorobut-1-en-2-yl acetate |
| SMILES | CCC(OC(C)=O)=C(Cl)Cl |
| InChI | InChI=1S/C6H8Cl2O2/c1-3-5(6(7)8)10-4(2)9/h3H2,1-2H3 |
| InChIKey | RVELYAJKCYNIMK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.03 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichlorobut-1-en-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichlorobut-1-en-2-yl acetate?
The IUPAC name of 1,1-dichlorobut-1-en-2-yl acetate (CID 88784840) is 1,1-dichlorobut-1-en-2-yl acetate.
What is the SMILES notation for 1,1-dichlorobut-1-en-2-yl acetate?
The canonical SMILES for 1,1-dichlorobut-1-en-2-yl acetate is CCC(OC(C)=O)=C(Cl)Cl.
What is the InChIKey of 1,1-dichlorobut-1-en-2-yl acetate?
The InChIKey is RVELYAJKCYNIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl2O2/c1-3-5(6(7)8)10-4(2)9/h3H2,1-2H3.
What are the key properties of 1,1-dichlorobut-1-en-2-yl acetate?
1,1-dichlorobut-1-en-2-yl acetate has a molecular weight of 183.03 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichlorobut-1-en-2-yl acetate is sourced from PubChem (CID 88784840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).