C6H3Cl9 — CID 57013230
1,1,1,2,3,4,4,5,5-nonachlorohex-2-ene (PubChem CID 57013230) has the molecular formula C6H3Cl9 and a molecular weight of 394.17 g/mol. Its IUPAC name is 1,1,1,2,3,4,4,5,5-nonachlorohex-2-ene.
| Compound Name | 1,1,1,2,3,4,4,5,5-nonachlorohex-2-ene |
|---|---|
| PubChem CID | 57013230 |
| Molecular Formula | C6H3Cl9 |
| Molecular Weight | 394.17 g/mol |
| Exact Mass | 389.74 |
| IUPAC Name | 1,1,1,2,3,4,4,5,5-nonachlorohex-2-ene |
| SMILES | CC(Cl)(Cl)C(Cl)(Cl)C(Cl)=C(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H3Cl9/c1-4(9,10)5(11,12)2(7)3(8)6(13,14)15/h1H3 |
| InChIKey | GHRLAVKVLAKXQQ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.17 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|