About chloromethane;thiocarbonyl dichloride
chloromethane;thiocarbonyl dichloride (PubChem CID 175090712) has the molecular formula C2H3Cl3S
and a molecular weight of 165.47 g/mol. Its IUPAC name is chloromethane;thiocarbonyl dichloride.
Molecular Properties
| Compound Name | chloromethane;thiocarbonyl dichloride |
| PubChem CID | 175090712 |
| Molecular Formula | C2H3Cl3S |
| Molecular Weight | 165.47 g/mol |
| Exact Mass | 163.90 |
| IUPAC Name | chloromethane;thiocarbonyl dichloride |
| SMILES | CCl.S=C(Cl)Cl |
| InChI | InChI=1S/CCl2S.CH3Cl/c2-1(3)4;1-2/h;1H3 |
| InChIKey | LFXJXFUWBCRLKZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;thiocarbonyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;thiocarbonyl dichloride?
The IUPAC name of chloromethane;thiocarbonyl dichloride (CID 175090712) is chloromethane;thiocarbonyl dichloride.
What is the SMILES notation for chloromethane;thiocarbonyl dichloride?
The canonical SMILES for chloromethane;thiocarbonyl dichloride is CCl.S=C(Cl)Cl.
What is the InChIKey of chloromethane;thiocarbonyl dichloride?
The InChIKey is LFXJXFUWBCRLKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/CCl2S.CH3Cl/c2-1(3)4;1-2/h;1H3.
What are the key properties of chloromethane;thiocarbonyl dichloride?
chloromethane;thiocarbonyl dichloride has a molecular weight of 165.47 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;thiocarbonyl dichloride is sourced from PubChem (CID 175090712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).