About CID 102017539
CID 102017539 (PubChem CID 102017539) has the molecular formula C2H4ClO
and a molecular weight of 79.51 g/mol.
Molecular Properties
| Compound Name | CID 102017539 |
| PubChem CID | 102017539 |
| Molecular Formula | C2H4ClO |
| Molecular Weight | 79.51 g/mol |
| Exact Mass | 79.00 |
| IUPAC Name | — |
| SMILES | C[C](O)Cl |
| InChI | InChI=1S/C2H4ClO/c1-2(3)4/h4H,1H3 |
| InChIKey | DPHNZJGNPHZODC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 79.51 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 102017539 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102017539?
The IUPAC name of CID 102017539 (CID 102017539) is not available.
What is the SMILES notation for CID 102017539?
The canonical SMILES for CID 102017539 is C[C](O)Cl.
What is the InChIKey of CID 102017539?
The InChIKey is DPHNZJGNPHZODC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4ClO/c1-2(3)4/h4H,1H3.
What are the key properties of CID 102017539?
CID 102017539 has a molecular weight of 79.51 g/mol, XLogP of 1.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102017539 is sourced from PubChem (CID 102017539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).