C3H2Cl3F — CID 87135979
(E)-1,3,3-trichloro-1-fluoroprop-1-ene (PubChem CID 87135979) has the molecular formula C3H2Cl3F and a molecular weight of 163.41 g/mol. Its IUPAC name is (E)-1,3,3-trichloro-1-fluoroprop-1-ene.
| Compound Name | (E)-1,3,3-trichloro-1-fluoroprop-1-ene |
|---|---|
| PubChem CID | 87135979 |
| Molecular Formula | C3H2Cl3F |
| Molecular Weight | 163.41 g/mol |
| Exact Mass | 161.92 |
| IUPAC Name | (E)-1,3,3-trichloro-1-fluoroprop-1-ene |
| SMILES | F/C(Cl)=C\C(Cl)Cl |
| InChI | InChI=1S/C3H2Cl3F/c4-2(5)1-3(6)7/h1-2H/b3-1- |
| InChIKey | YYDPDTHRBQYLSK-IWQZZHSRSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|